CAS 312608-54-1 appears in our catalog under these names: MID–1, MID-1 99%, MID-1, 99.36%, MID-1/ 99.61% (existing batch purity), 4-Ethoxy-N-(5-nitro-1,3-thiazol-2-yl)benzamide. Offered by: GLPBio, Ambeed, MedChemExpress, TargetMol, Biosynth. Available pack sizes: 1mg, 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 250mg.
4-ethoxy-N-(5-nitro-1,3-thiazol-2-yl)benzamide (CAS 312608-54-1) is a chemical compound with the molecular formula C12H11N3O4S and a molecular weight of 293.30 g/mol. IUPAC name: 4-ethoxy-N-(5-nitro-1,3-thiazol-2-yl)benzamide. InChIKey: LMDLIMGAGZHZSR-UHFFFAOYSA-N.
| Molecular formula | C12H11N3O4S |
|---|---|
| Molecular weight | 293.30 g/mol |
| IUPAC name | 4-ethoxy-N-(5-nitro-1,3-thiazol-2-yl)benzamide |
| InChIKey | LMDLIMGAGZHZSR-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C(=O)NC2=NC=C(S2)[N+](=O)[O-] |
Computed by PubChem (NCBI)