Products 6616-56-4

CAS 6616-56-4 appears in our catalog under these names: MSX-127/ 99.61% (existing batch purity), MSX–127, 2,5-bis((morpholin-4-yl)methyl)benzene-1,4-diol, MSX-127 95%, MSX-127, 95%, 95%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 250mg, 1g.

Structural formula: {0} (CAS {1})

2,5-bis(morpholin-4-ylmethyl)benzene-1,4-diol (CAS 6616-56-4) is a chemical compound with the molecular formula C16H24N2O4 and a molecular weight of 308.37 g/mol. IUPAC name: 2,5-bis(morpholin-4-ylmethyl)benzene-1,4-diol. InChIKey: DGGCIZWVIVXHFR-UHFFFAOYSA-N.

Identity
Molecular formulaC16H24N2O4
Molecular weight308.37 g/mol
IUPAC name2,5-bis(morpholin-4-ylmethyl)benzene-1,4-diol
InChIKeyDGGCIZWVIVXHFR-UHFFFAOYSA-N
SMILESC1COCCN1CC2=CC(=C(C=C2O)CN3CCOCC3)O

Computed by PubChem (NCBI)