cas: 173323-23-4 — see every product listed under this CAS number, including other names
Mal-O2Oc-OH (CAS 173323-23-4) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg, 500mg. Offered by: Iris Biotech.
| brand | Iris Biotech |
|---|---|
| catalog number | PEG4870.0001 |
| cas | 173323-23-4 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Iris Biotech | 1g | 1233.58 Pln | |
| Iris Biotech | 5g | 4122.80 Pln | |
| Iris Biotech | 250mg | 511.28 Pln | |
| Iris Biotech | 500mg | 832.30 Pln |
| purity | No data |
|---|---|
| delivery time | 2 weeks |
2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetic acid (CAS 173323-23-4) is a chemical compound with the molecular formula C10H13NO6 and a molecular weight of 243.21 g/mol. IUPAC name: 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetic acid. InChIKey: AZIIPBGZTZIKMC-UHFFFAOYSA-N.
| Molecular formula | C10H13NO6 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetic acid |
| InChIKey | AZIIPBGZTZIKMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCC(=O)O |
Computed by PubChem (NCBI)