Products 1511700-07-4

CAS 1511700-07-4 is the registry number for Pentanedioic acid 2,5-dioxo-pyrrolidin-1-yl ester methyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 250mg, 1g.

Structural formula: {0} (CAS {1})

5-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl pentanedioate (CAS 1511700-07-4) is a chemical compound with the molecular formula C10H13NO6 and a molecular weight of 243.21 g/mol. IUPAC name: 5-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl pentanedioate. InChIKey: VGVQMVBXFLYTSS-UHFFFAOYSA-N.

Identity
Molecular formulaC10H13NO6
Molecular weight243.21 g/mol
IUPAC name5-O-(2,5-dioxopyrrolidin-1-yl) 1-O-methyl pentanedioate
InChIKeyVGVQMVBXFLYTSS-UHFFFAOYSA-N
SMILESCOC(=O)CCCC(=O)ON1C(=O)CCC1=O

Computed by PubChem (NCBI)