CAS 118380-07-7 appears in our catalog under these names: 6–((2,5–Dioxopyrrolidin–1–yl)oxy)–6–oxohexanoic acid, 6-((2,5-Dioxopyrrolidin-1-yl)oxy)-6-oxohexanoic acid, 98%, 98%, 6-((2,5-Dioxopyrrolidin-1-yl)oxy)-6-oxohexanoic acid, 95.0%, 6-((2,5-Dioxopyrrolidin-1-yl)oxy)-6-oxohexanoic acid, 97%, 6-((2,5-Dioxopyrrolidin-1-yl)oxy)-6-oxohexanoic acid, 98%. Offered by: GLPBio, Chemat, MedChemExpress, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 1 g, 250 mg, 100 mg, 500 mg.
6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexanoic acid (CAS 118380-07-7) is a chemical compound with the molecular formula C10H13NO6 and a molecular weight of 243.21 g/mol. IUPAC name: 6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexanoic acid. InChIKey: JWUFSYXQWPXFIL-UHFFFAOYSA-N.
| Molecular formula | C10H13NO6 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 6-(2,5-dioxopyrrolidin-1-yl)oxy-6-oxohexanoic acid |
| InChIKey | JWUFSYXQWPXFIL-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCCCC(=O)O |
Computed by PubChem (NCBI)