CAS 173323-23-4 appears in our catalog under these names: (2-[2-(2,5-Dioxo-2,5-dihydro-1h-pyrrol-1-yl)ethoxy]ethoxy)acetic acid, 95%, 2-(2-(2-(2,5-Dihydro-2,5-dioxo-1H-pyrrol-1-yl)ethoxy)ethoxy)acetic Acid, Mal-O2Oc-OH, Mal-PEG2-CH2COOH, Mal-PEG2-CH2COOH, 97%. Offered by: Combi-blocks, TRC, Iris Biotech, MedChemExpress, Ambeed. Available pack sizes: 250mg, 1g, 100mg, 5g, 500mg, 50 mg, 250 mg, 100 mg.
2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetic acid (CAS 173323-23-4) is a chemical compound with the molecular formula C10H13NO6 and a molecular weight of 243.21 g/mol. IUPAC name: 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetic acid. InChIKey: AZIIPBGZTZIKMC-UHFFFAOYSA-N.
| Molecular formula | C10H13NO6 |
|---|---|
| Molecular weight | 243.21 g/mol |
| IUPAC name | 2-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]acetic acid |
| InChIKey | AZIIPBGZTZIKMC-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCOCCOCC(=O)O |
Computed by PubChem (NCBI)