cas: 1374666-31-5 — see every product listed under this CAS number, including other names
Mal-peg2-t-butyl ester 98% (CAS 1374666-31-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A754695-100mg |
| cas | 1374666-31-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 537.25 Pln | |
| Ambeed | 1g | 993.38 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A754695 |
Tert-butyl 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate (CAS 1374666-31-5) is a chemical compound with the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. IUPAC name: tert-butyl 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate. InChIKey: XWPBPQDTQUEMBX-UHFFFAOYSA-N.
| Molecular formula | C15H23NO6 |
|---|---|
| Molecular weight | 313.35 g/mol |
| IUPAC name | tert-butyl 3-[2-[2-(2,5-dioxopyrrol-1-yl)ethoxy]ethoxy]propanoate |
| InChIKey | XWPBPQDTQUEMBX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCN1C(=O)C=CC1=O |
Computed by PubChem (NCBI)