CAS 23971-42-8 appears in our catalog under these names: Meranzin, Meranzin/ 95.08% (existing batch purity), Meranzin 98+%, Meranzin, 98+%, 98+%, Meranzin (Standard). Offered by: GLPBio, TargetMol, Biosynth, Chemat, Ambeed. Available pack sizes: 1mg, 10mg, 5mg, 25mg, 50mg, 2mg, 100mg, 250mg.
8-[[(2S)-3,3-dimethyloxiran-2-yl]methyl]-7-methoxychromen-2-one (CAS 23971-42-8) is a chemical compound with the molecular formula C15H16O4 and a molecular weight of 260.28 g/mol. IUPAC name: 8-[[(2S)-3,3-dimethyloxiran-2-yl]methyl]-7-methoxychromen-2-one. InChIKey: LSZONYLDFHGRDP-LBPRGKRZSA-N.
| Molecular formula | C15H16O4 |
|---|---|
| Molecular weight | 260.28 g/mol |
| IUPAC name | 8-[[(2S)-3,3-dimethyloxiran-2-yl]methyl]-7-methoxychromen-2-one |
| InChIKey | LSZONYLDFHGRDP-LBPRGKRZSA-N |
| SMILES | CC1([C@@H](O1)CC2=C(C=CC3=C2OC(=O)C=C3)OC)C |
Computed by PubChem (NCBI)