cas: 4408-60-0 — see every product listed under this CAS number, including other names
Mesityleneacetic Acid, >98.0%(T)(GC) (CAS 4408-60-0) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | M1218-5G |
| cas | 4408-60-0 |
| size | 5g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 5g | 614.99 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >98.0%(T)(GC) |
2-(2,4,6-trimethylphenyl)acetic acid (CAS 4408-60-0) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 2-(2,4,6-trimethylphenyl)acetic acid. InChIKey: CQWMQAKKAHTCSC-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 2-(2,4,6-trimethylphenyl)acetic acid |
| InChIKey | CQWMQAKKAHTCSC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CC(=O)O)C |
Computed by PubChem (NCBI)