Products 4408-60-0
CAS 4408-60-0 appears in our catalog under these names: 2,4,6-Trimethylphenylacetic acid, 98%, Mesitylacetic acid, Mesitylacetic acid/ 98+%, 2,4,6-Trimethylphenylacetic acid, Mesityleneacetic Acid, >98.0%(T)(GC). Offered by: Combi-blocks, GLPBio, Chemat, Biosynth, TCI. Available pack sizes: 5g, 100g, 25g, 500g, 1kg, 0,1kg, 0,05kg, 0,25kg.
2-(2,4,6-trimethylphenyl)acetic acid (CAS 4408-60-0) is a chemical compound with the molecular formula C11H14O2 and a molecular weight of 178.23 g/mol. IUPAC name: 2-(2,4,6-trimethylphenyl)acetic acid. InChIKey: CQWMQAKKAHTCSC-UHFFFAOYSA-N.
| Molecular formula | C11H14O2 |
|---|---|
| Molecular weight | 178.23 g/mol |
| IUPAC name | 2-(2,4,6-trimethylphenyl)acetic acid |
| InChIKey | CQWMQAKKAHTCSC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)CC(=O)O)C |
Computed by PubChem (NCBI)
Synonyms:
Mesitylacetic acid, 2-(2,4,6-trimethylphenyl)acetic acid, (2,4,6-Trimethylphenyl)acetic acid, Benzeneacetic acid, 2,4,6-trimethyl-, 2,4,6-Trimethylbenzeneacetic Acid, (2,4,6Trimethylphenyl)acetic acid, 2-Mesitylacetic acid, 2,4,6-Trimethylphenylacetic acid, Mesityleneacetic Acid, Mesitylessigsaure