CAS 125160-21-6 is the registry number for Methyl (E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acrylate, 95%. Offered by: Ambeed. Available pack sizes: 5g, 250mg.
Methyl (E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate (CAS 125160-21-6) is a chemical compound with the molecular formula C10H17BO4 and a molecular weight of 212.05 g/mol. IUPAC name: methyl (E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate. InChIKey: YRXVNAIOQAUBNO-VOTSOKGWSA-N.
| Molecular formula | C10H17BO4 |
|---|---|
| Molecular weight | 212.05 g/mol |
| IUPAC name | methyl (E)-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate |
| InChIKey | YRXVNAIOQAUBNO-VOTSOKGWSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/C(=O)OC |
Computed by PubChem (NCBI)