cas: 210962-91-7 — see every product listed under this CAS number, including other names
Methyl (R)-2-((tert-butoxycarbonyl)amino)-3-(4-iodophenyl)propanoate, 98% (CAS 210962-91-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F603652-250MG |
| cas | 210962-91-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 706.02 Pln | |
| Fluorochem | 1g | 1513.03 Pln | |
| Fluorochem | 5g | 4465.11 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl (2R)-3-(4-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 210962-91-7) is a chemical compound with the molecular formula C15H20INO4 and a molecular weight of 405.23 g/mol. IUPAC name: methyl (2R)-3-(4-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: HNCUXLSIVYDGBW-GFCCVEGCSA-N.
| Molecular formula | C15H20INO4 |
|---|---|
| Molecular weight | 405.23 g/mol |
| IUPAC name | methyl (2R)-3-(4-iodophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | HNCUXLSIVYDGBW-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)I)C(=O)OC |
Computed by PubChem (NCBI)