cas: 70375-79-0 — see every product listed under this CAS number, including other names
Methyl 1,5-diphenyl-1H-pyrazole-3-carboxylate, 96%, 96% (CAS 70375-79-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116VAD-100mg |
| cas | 70375-79-0 |
| size | 100mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 170.00 Pln | |
| Chemat | 250mg | 246.80 Pln | |
| Chemat | 1g | 558.80 Pln | |
| Chemat | 5g | 1552.40 Pln |
| purity | 96% |
|---|---|
| delivery time | 3 weeks |
Methyl 1,5-diphenylpyrazole-3-carboxylate (CAS 70375-79-0) is a chemical compound with the molecular formula C17H14N2O2 and a molecular weight of 278.30 g/mol. IUPAC name: methyl 1,5-diphenylpyrazole-3-carboxylate. InChIKey: XDUCEEQKAOPMAY-UHFFFAOYSA-N.
| Molecular formula | C17H14N2O2 |
|---|---|
| Molecular weight | 278.30 g/mol |
| IUPAC name | methyl 1,5-diphenylpyrazole-3-carboxylate |
| InChIKey | XDUCEEQKAOPMAY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=NN(C(=C1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)