cas: 880166-10-9 — see every product listed under this CAS number, including other names
Methyl 1-((tert-butoxycarbonyl)amino)cyclobutanecarboxylate 97% (CAS 880166-10-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A187866-250mg |
| cas | 880166-10-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1432.81 Pln | |
| Ambeed | 10g | 2539.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A187866 |
Methyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylate (CAS 880166-10-9) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: methyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylate. InChIKey: SRRLSLUOBZWDNA-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | methyl 1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylate |
| InChIKey | SRRLSLUOBZWDNA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CCC1)C(=O)OC |
Computed by PubChem (NCBI)