cas: 37493-34-8 — see every product listed under this CAS number, including other names
Methyl 1-methyl-1H-indole-2-carboxylate, 98% (CAS 37493-34-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 2.5g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F329157-1G |
| cas | 37493-34-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 279.09 Pln | |
| Fluorochem | 2.5g | 471.73 Pln | |
| Fluorochem | 5g | 789.32 Pln | |
| Fluorochem | 10g | 1351.63 Pln | |
| Fluorochem | 25g | 2351.27 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 1-methylindole-2-carboxylate (CAS 37493-34-8) is a chemical compound with the molecular formula C11H11NO2 and a molecular weight of 189.21 g/mol. IUPAC name: methyl 1-methylindole-2-carboxylate. InChIKey: PEHJJMYCHVPFCG-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2 |
|---|---|
| Molecular weight | 189.21 g/mol |
| IUPAC name | methyl 1-methylindole-2-carboxylate |
| InChIKey | PEHJJMYCHVPFCG-UHFFFAOYSA-N |
| SMILES | CN1C2=CC=CC=C2C=C1C(=O)OC |
Computed by PubChem (NCBI)