cas: 42021-12-5 — see every product listed under this CAS number, including other names
Methyl 1H,2H,3H,4H,9H-pyrido(3,4-b)indole-3-carboxylate hydrochloride, 95% (CAS 42021-12-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1088498-1g |
| cas | 42021-12-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 1326.43 Pln | |
| AmBeed | 5g | 3845.80 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride (CAS 42021-12-5) is a chemical compound with the molecular formula C13H15ClN2O2 and a molecular weight of 266.72 g/mol. IUPAC name: methyl 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride. InChIKey: JQYBNWMURCUTIC-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O2 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | methyl 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride |
| InChIKey | JQYBNWMURCUTIC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(CN1)NC3=CC=CC=C23.Cl |
Computed by PubChem (NCBI)