CAS 42021-12-5 appears in our catalog under these names: Methyl 2,3,4,9-tetrahydro-1h-beta-carboline-3-carboxylate hydrochloride, 95%, Methyl 1H,2H,3H,4H,9H-pyrido(3,4-b)indole-3-carboxylate hydrochloride, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 5g, 250mg.
Methyl 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride (CAS 42021-12-5) is a chemical compound with the molecular formula C13H15ClN2O2 and a molecular weight of 266.72 g/mol. IUPAC name: methyl 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride. InChIKey: JQYBNWMURCUTIC-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O2 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | methyl 2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride |
| InChIKey | JQYBNWMURCUTIC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1CC2=C(CN1)NC3=CC=CC=C23.Cl |
Computed by PubChem (NCBI)