CAS 40431-45-6 appears in our catalog under these names: 2-Methyl-2,3,4,5-tetrahydro-1h-pyrido[4,3-b]indole-8-carboxylic acid hydrochloride, 98%, 2-Methyl-2,3,4,5-tetrahydro-1H-pyrido[4,3-b]indole-8-carboxylic acid hydrochloride, 95%, 95%. Offered by: Combi-blocks, Chemat. Available pack sizes: 100mg, 250mg, 5g, 1g.
2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid;hydrochloride (CAS 40431-45-6) is a chemical compound with the molecular formula C13H15ClN2O2 and a molecular weight of 266.72 g/mol. IUPAC name: 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid;hydrochloride. InChIKey: ULUFFFPURQWXJJ-UHFFFAOYSA-N.
| Molecular formula | C13H15ClN2O2 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | 2-methyl-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylic acid;hydrochloride |
| InChIKey | ULUFFFPURQWXJJ-UHFFFAOYSA-N |
| SMILES | CN1CCC2=C(C1)C3=C(N2)C=CC(=C3)C(=O)O.Cl |
Computed by PubChem (NCBI)