CAS 83159-19-7 appears in our catalog under these names: H-Tpi-ome hydrochloride, 95%, L-1,2,3,4-Tetrahydronorharman-3-carboxylic Acid Methyl Ester Hydrochloride. Offered by: Combi-blocks, TRC. Available pack sizes: 5g, 250mg, 1g, 500mg.
Methyl (3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride (CAS 83159-19-7) is a chemical compound with the molecular formula C13H15ClN2O2 and a molecular weight of 266.72 g/mol. IUPAC name: methyl (3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride. InChIKey: JQYBNWMURCUTIC-MERQFXBCSA-N.
| Molecular formula | C13H15ClN2O2 |
|---|---|
| Molecular weight | 266.72 g/mol |
| IUPAC name | methyl (3S)-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole-3-carboxylate;hydrochloride |
| InChIKey | JQYBNWMURCUTIC-MERQFXBCSA-N |
| SMILES | COC(=O)[C@@H]1CC2=C(CN1)NC3=CC=CC=C23.Cl |
Computed by PubChem (NCBI)