cas: 773873-68-0 — see every product listed under this CAS number, including other names
Methyl 2,3,4-trifluorobenzoate 98% (CAS 773873-68-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A753377-1g |
| cas | 773873-68-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 292.50 Pln | |
| Ambeed | 10g | 353.69 Pln | |
| Ambeed | 25g | 631.81 Pln | |
| Ambeed | 100g | 1755.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A753377 |
Methyl 2,3,4-trifluorobenzoate (CAS 773873-68-0) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: methyl 2,3,4-trifluorobenzoate. InChIKey: JHPAOEXOUXURFL-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | methyl 2,3,4-trifluorobenzoate |
| InChIKey | JHPAOEXOUXURFL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)F)F)F |
Computed by PubChem (NCBI)