cas: 773873-68-0 — see every product listed under this CAS number, including other names
Methyl 2,3,4-trifluorobenzoate, 98%, 98% (CAS 773873-68-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G3SF-250mg |
| cas | 773873-68-0 |
| size | 250mg |
| availability | 500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 88.40 Pln | |
| Chemat | 1g | 122.00 Pln | |
| Chemat | 5g | 232.40 Pln | |
| Chemat | 10g | 275.60 Pln | |
| Chemat | 25g | 491.60 Pln | |
| Chemat | 100g | 1355.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2,3,4-trifluorobenzoate (CAS 773873-68-0) is a chemical compound with the molecular formula C8H5F3O2 and a molecular weight of 190.12 g/mol. IUPAC name: methyl 2,3,4-trifluorobenzoate. InChIKey: JHPAOEXOUXURFL-UHFFFAOYSA-N.
| Molecular formula | C8H5F3O2 |
|---|---|
| Molecular weight | 190.12 g/mol |
| IUPAC name | methyl 2,3,4-trifluorobenzoate |
| InChIKey | JHPAOEXOUXURFL-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=C(C=C1)F)F)F |
Computed by PubChem (NCBI)