cas: 4099-85-8 — see every product listed under this CAS number, including other names
Methyl 2,3-O-Isopropylidene-β-D-ribofuranoside 95% (CAS 4099-85-8) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A237164-500g |
| cas | 4099-85-8 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 7401.38 Pln | |
| Ambeed | 250mg | 120.06 Pln | |
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 10g | 464.94 Pln | |
| Ambeed | 25g | 698.56 Pln | |
| Ambeed | 100g | 1905.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A237164 |
[(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol (CAS 4099-85-8) is a chemical compound with the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. IUPAC name: [(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol. InChIKey: DXBHDBLZPXQALN-WCTZXXKLSA-N.
| Molecular formula | C9H16O5 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | [(3aR,4R,6R,6aR)-4-methoxy-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methanol |
| InChIKey | DXBHDBLZPXQALN-WCTZXXKLSA-N |
| SMILES | CC1(O[C@@H]2[C@H](O[C@H]([C@@H]2O1)OC)CO)C |
Computed by PubChem (NCBI)