cas: 1807032-88-7 — see every product listed under this CAS number, including other names
Methyl 2,3-dibromo-6-fluorobenzoate (CAS 1807032-88-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 500mg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F630722-250MG |
| cas | 1807032-88-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 7276.62 Pln | |
| Fluorochem | 500mg | 8255.44 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 2,3-dibromo-6-fluorobenzoate (CAS 1807032-88-7) is a chemical compound with the molecular formula C8H5Br2FO2 and a molecular weight of 311.93 g/mol. IUPAC name: methyl 2,3-dibromo-6-fluorobenzoate. InChIKey: ZPASMKRORGSCHV-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2FO2 |
|---|---|
| Molecular weight | 311.93 g/mol |
| IUPAC name | methyl 2,3-dibromo-6-fluorobenzoate |
| InChIKey | ZPASMKRORGSCHV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1Br)Br)F |
Computed by PubChem (NCBI)