CAS 2413441-14-0 appears in our catalog under these names: 4,6-Dibromo-2-fluoro-3-methoxybenzaldehyde, 95%, 4,6-Dibromo-2-fluoro-3-methoxybenzaldehyde. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
4,6-dibromo-2-fluoro-3-methoxybenzaldehyde (CAS 2413441-14-0) is a chemical compound with the molecular formula C8H5Br2FO2 and a molecular weight of 311.93 g/mol. IUPAC name: 4,6-dibromo-2-fluoro-3-methoxybenzaldehyde. InChIKey: BEDZTXMWEVQGDA-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2FO2 |
|---|---|
| Molecular weight | 311.93 g/mol |
| IUPAC name | 4,6-dibromo-2-fluoro-3-methoxybenzaldehyde |
| InChIKey | BEDZTXMWEVQGDA-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1F)C=O)Br)Br |
Computed by PubChem (NCBI)