Products 1214329-17-5
CAS 1214329-17-5 appears in our catalog under these names: Methyl 3,6-dibromo-2-fluorobenzoate, 95%, Methyl 3,6-dibromo-2-fluorobenzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Methyl 3,6-dibromo-2-fluorobenzoate (CAS 1214329-17-5) is a chemical compound with the molecular formula C8H5Br2FO2 and a molecular weight of 311.93 g/mol. IUPAC name: methyl 3,6-dibromo-2-fluorobenzoate. InChIKey: KXPXTWFPQYWOHR-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2FO2 |
|---|---|
| Molecular weight | 311.93 g/mol |
| IUPAC name | methyl 3,6-dibromo-2-fluorobenzoate |
| InChIKey | KXPXTWFPQYWOHR-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1F)Br)Br |
Computed by PubChem (NCBI)