CAS 1806294-86-9 appears in our catalog under these names: Methyl 2,6-dibromo-4-fluorobenzoate, 95%, Methyl 2,6-dibromo-4-fluorobenzoate, 97%, Methyl 2,6-dibromo-4-fluorobenzoate. Offered by: Combi-blocks, AmBeed, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Methyl 2,6-dibromo-4-fluorobenzoate (CAS 1806294-86-9) is a chemical compound with the molecular formula C8H5Br2FO2 and a molecular weight of 311.93 g/mol. IUPAC name: methyl 2,6-dibromo-4-fluorobenzoate. InChIKey: LPQPZOPJJVTWRO-UHFFFAOYSA-N.
| Molecular formula | C8H5Br2FO2 |
|---|---|
| Molecular weight | 311.93 g/mol |
| IUPAC name | methyl 2,6-dibromo-4-fluorobenzoate |
| InChIKey | LPQPZOPJJVTWRO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Br)F)Br |
Computed by PubChem (NCBI)