cas: 1398504-37-4 — see every product listed under this CAS number, including other names
Methyl 2,4-dichloro-6-fluorobenzoate 98% (CAS 1398504-37-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A178155-250mg |
| cas | 1398504-37-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 487.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A178155 |
Methyl 2,4-dichloro-6-fluorobenzoate (CAS 1398504-37-4) is a chemical compound with the molecular formula C8H5Cl2FO2 and a molecular weight of 223.02 g/mol. IUPAC name: methyl 2,4-dichloro-6-fluorobenzoate. InChIKey: NYSVGJCOIGNBSV-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2FO2 |
|---|---|
| Molecular weight | 223.02 g/mol |
| IUPAC name | methyl 2,4-dichloro-6-fluorobenzoate |
| InChIKey | NYSVGJCOIGNBSV-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=C(C=C1Cl)Cl)F |
Computed by PubChem (NCBI)