Methyl 2,4-dioxo-4-(pyridin-4-yl)butanoate, 95+%
cas: 374063-91-9 — see every product listed under this CAS number, including other names
Methyl 2,4-dioxo-4-(pyridin-4-yl)butanoate, 95+% (CAS 374063-91-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A536037-250mg |
| cas | 374063-91-9 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 442.69 Pln | |
| Ambeed | 1g | 1104.63 Pln | |
| Ambeed | 5g | 3824.69 Pln | |
| Chemat | 100mg | 395.60 Pln | |
| Chemat | 250mg | 626.00 Pln | |
| Chemat | 1g | 1581.20 Pln | |
| Chemat | 5g | 5358.80 Pln | |
| BLDpharm | 100mg | 319.91 Pln | |
| BLDpharm | 250mg | 469.86 Pln | |
| BLDpharm | 1g | 1180.72 Pln | |
| BLDpharm | 5g | 4118.57 Pln |
properties
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
Methyl 2,4-dioxo-4-pyridin-4-ylbutanoate (CAS 374063-91-9) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: methyl 2,4-dioxo-4-pyridin-4-ylbutanoate. InChIKey: WOCFUTQLECHXPN-UHFFFAOYSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | methyl 2,4-dioxo-4-pyridin-4-ylbutanoate |
| InChIKey | WOCFUTQLECHXPN-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)C1=CC=NC=C1 |
Computed by PubChem (NCBI)