CAS 16633-46-8 appears in our catalog under these names: Trans-2-(4-nitrophenyl)cyclopropanecarboxylic acid, 95%, rac-(1R,2R)-2-(4-Nitrophenyl)cyclopropane-1-carboxylic acid, trans-2-(4-Nitrophenyl)cyclopropanecarboxylic acid, 95%, 95%. Offered by: Combi-blocks, Biosynth, Chemat, Ambeed. Available pack sizes: 250mg, 1g, 50mg, 0,5g, 100mg.
Trans-(1R,2R)-2-(4-nitrophenyl)cyclopropane-1-carboxylic acid (CAS 16633-46-8) is a chemical compound with the molecular formula C10H9NO4 and a molecular weight of 207.18 g/mol. IUPAC name: trans-(1R,2R)-2-(4-nitrophenyl)cyclopropane-1-carboxylic acid. InChIKey: BIHOAKPNPOGWEV-DTWKUNHWSA-N.
| Molecular formula | C10H9NO4 |
|---|---|
| Molecular weight | 207.18 g/mol |
| IUPAC name | trans-(1R,2R)-2-(4-nitrophenyl)cyclopropane-1-carboxylic acid |
| InChIKey | BIHOAKPNPOGWEV-DTWKUNHWSA-N |
| SMILES | C1[C@H]([C@@H]1C(=O)O)C2=CC=C(C=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)