cas: 2145093-94-1 — see every product listed under this CAS number, including other names
Methyl 2,6-dimethoxy-5-methylpyridine-3-carboxylate (CAS 2145093-94-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F632851-1G |
| cas | 2145093-94-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 7969.09 Pln |
| delivery time | 3-4 weeks |
|---|
Methyl 2,6-dimethoxy-5-methylpyridine-3-carboxylate (CAS 2145093-94-1) is a chemical compound with the molecular formula C10H13NO4 and a molecular weight of 211.21 g/mol. IUPAC name: methyl 2,6-dimethoxy-5-methylpyridine-3-carboxylate. InChIKey: VGEMYVQPDYTVMU-UHFFFAOYSA-N.
| Molecular formula | C10H13NO4 |
|---|---|
| Molecular weight | 211.21 g/mol |
| IUPAC name | methyl 2,6-dimethoxy-5-methylpyridine-3-carboxylate |
| InChIKey | VGEMYVQPDYTVMU-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(N=C1OC)OC)C(=O)OC |
Computed by PubChem (NCBI)