cas: 4697-57-8 — see every product listed under this CAS number, including other names
Methyl 2-(2-bromo-4,5-dimethoxyphenyl)acetate 98% (CAS 4697-57-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A982902-250mg |
| cas | 4697-57-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 437.12 Pln | |
| Ambeed | 5g | 1510.69 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A982902 |
Methyl 2-(2-bromo-4,5-dimethoxyphenyl)acetate (CAS 4697-57-8) is a chemical compound with the molecular formula C11H13BrO4 and a molecular weight of 289.12 g/mol. IUPAC name: methyl 2-(2-bromo-4,5-dimethoxyphenyl)acetate. InChIKey: UIVBNMQTXLCVTF-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO4 |
|---|---|
| Molecular weight | 289.12 g/mol |
| IUPAC name | methyl 2-(2-bromo-4,5-dimethoxyphenyl)acetate |
| InChIKey | UIVBNMQTXLCVTF-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C(=C1)CC(=O)OC)Br)OC |
Computed by PubChem (NCBI)