Products 1044563-86-1

CAS 1044563-86-1 is the registry number for 4-Bromo-3-(3-methoxypropoxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-bromo-3-(3-methoxypropoxy)benzoic acid (CAS 1044563-86-1) is a chemical compound with the molecular formula C11H13BrO4 and a molecular weight of 289.12 g/mol. IUPAC name: 4-bromo-3-(3-methoxypropoxy)benzoic acid. InChIKey: VZOFJBNFIGRJTJ-UHFFFAOYSA-N.

Identity
Molecular formulaC11H13BrO4
Molecular weight289.12 g/mol
IUPAC name4-bromo-3-(3-methoxypropoxy)benzoic acid
InChIKeyVZOFJBNFIGRJTJ-UHFFFAOYSA-N
SMILESCOCCCOC1=C(C=CC(=C1)C(=O)O)Br

Computed by PubChem (NCBI)