CAS 54109-14-7 appears in our catalog under these names: 2-Bromo-1-(2,3,4-trimethoxy-phenyl)-ethanone, 95%, 2-Bromo-1-(2,3,4-trimethoxyphenyl)-ethanone. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 1g, 100mg, 250mg.
2-bromo-1-(2,3,4-trimethoxyphenyl)ethanone (CAS 54109-14-7) is a chemical compound with the molecular formula C11H13BrO4 and a molecular weight of 289.12 g/mol. IUPAC name: 2-bromo-1-(2,3,4-trimethoxyphenyl)ethanone. InChIKey: WUDJYUXZDGECRF-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO4 |
|---|---|
| Molecular weight | 289.12 g/mol |
| IUPAC name | 2-bromo-1-(2,3,4-trimethoxyphenyl)ethanone |
| InChIKey | WUDJYUXZDGECRF-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C(=O)CBr)OC)OC |
Computed by PubChem (NCBI)