CAS 745026-69-1 is the registry number for Ethyl 4-bromo-3,5-dimethoxybenzoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 250mg, 5g, 10g.
Ethyl 4-bromo-3,5-dimethoxybenzoate (CAS 745026-69-1) is a chemical compound with the molecular formula C11H13BrO4 and a molecular weight of 289.12 g/mol. IUPAC name: ethyl 4-bromo-3,5-dimethoxybenzoate. InChIKey: JRGSBGWQRXWQLD-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO4 |
|---|---|
| Molecular weight | 289.12 g/mol |
| IUPAC name | ethyl 4-bromo-3,5-dimethoxybenzoate |
| InChIKey | JRGSBGWQRXWQLD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)OC)Br)OC |
Computed by PubChem (NCBI)