CAS 1017540-91-8 appears in our catalog under these names: Methyl 2-(3-azaspiro[5.5]undecan-9-yl)acetate hydrochloride, 95%, Methyl 2-{3-azaspiro(5.5)undecan-9-yl}acetate hydrochloride, Methyl 2-(3-azaspiro[5.5]undecan-9-yl)acetate hydrochloride, 97%, 97%, METHYL 2-(3-AZASPIRO[5.5]UNDECAN-9-YL)ACETATE HCL, 98%, Methyl 2-(3-azaspiro[5.5]undecan-9-yl)acetate hydrochloride, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 50mg, 5g, 500mg.
Methyl 2-(3-azaspiro[5.5]undecan-9-yl)acetate;hydrochloride (CAS 1017540-91-8) is a chemical compound with the molecular formula C13H24ClNO2 and a molecular weight of 261.79 g/mol. IUPAC name: methyl 2-(3-azaspiro[5.5]undecan-9-yl)acetate;hydrochloride. InChIKey: JJLDFWAJKSRBSJ-UHFFFAOYSA-N.
| Molecular formula | C13H24ClNO2 |
|---|---|
| Molecular weight | 261.79 g/mol |
| IUPAC name | methyl 2-(3-azaspiro[5.5]undecan-9-yl)acetate;hydrochloride |
| InChIKey | JJLDFWAJKSRBSJ-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1CCC2(CC1)CCNCC2.Cl |
Computed by PubChem (NCBI)