Products 1580523-45-0

CAS 1580523-45-0 is the registry number for 3-(2-Cyclohexylpyrrolidin-1-yl)propanoic acid hydrochloride, 95%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

3-(2-cyclohexylpyrrolidin-1-yl)propanoic acid;hydrochloride (CAS 1580523-45-0) is a chemical compound with the molecular formula C13H24ClNO2 and a molecular weight of 261.79 g/mol. IUPAC name: 3-(2-cyclohexylpyrrolidin-1-yl)propanoic acid;hydrochloride. InChIKey: BBOZUMHMVAJGLE-UHFFFAOYSA-N.

Identity
Molecular formulaC13H24ClNO2
Molecular weight261.79 g/mol
IUPAC name3-(2-cyclohexylpyrrolidin-1-yl)propanoic acid;hydrochloride
InChIKeyBBOZUMHMVAJGLE-UHFFFAOYSA-N
SMILESC1CCC(CC1)C2CCCN2CCC(=O)O.Cl

Computed by PubChem (NCBI)