Products 2411196-32-0

CAS 2411196-32-0 is the registry number for Methyl 5-cyclohexylpiperidine-2-carboxylate hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.

Structural formula: {0} (CAS {1})

Methyl 5-cyclohexylpiperidine-2-carboxylate;hydrochloride (CAS 2411196-32-0) is a chemical compound with the molecular formula C13H24ClNO2 and a molecular weight of 261.79 g/mol. IUPAC name: methyl 5-cyclohexylpiperidine-2-carboxylate;hydrochloride. InChIKey: DFBNVUDPGSIAPM-UHFFFAOYSA-N.

Identity
Molecular formulaC13H24ClNO2
Molecular weight261.79 g/mol
IUPAC namemethyl 5-cyclohexylpiperidine-2-carboxylate;hydrochloride
InChIKeyDFBNVUDPGSIAPM-UHFFFAOYSA-N
SMILESCOC(=O)C1CCC(CN1)C2CCCCC2.Cl

Computed by PubChem (NCBI)