Products 2866319-12-0

CAS 2866319-12-0 is the registry number for tert-butyl 7-azaspiro[3.5]nonane-2-carboxylate hydrochloride, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 5g.

Structural formula: {0} (CAS {1})

Tert-butyl 7-azaspiro[3.5]nonane-2-carboxylate;hydrochloride (CAS 2866319-12-0) is a chemical compound with the molecular formula C13H24ClNO2 and a molecular weight of 261.79 g/mol. IUPAC name: tert-butyl 7-azaspiro[3.5]nonane-2-carboxylate;hydrochloride. InChIKey: QCCYTDYLOMKIKH-UHFFFAOYSA-N.

Identity
Molecular formulaC13H24ClNO2
Molecular weight261.79 g/mol
IUPAC nametert-butyl 7-azaspiro[3.5]nonane-2-carboxylate;hydrochloride
InChIKeyQCCYTDYLOMKIKH-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1CC2(C1)CCNCC2.Cl

Computed by PubChem (NCBI)