cas: 112918-77-1 — see every product listed under this CAS number, including other names
Methyl 2-(4-((tert-butoxycarbonyl)amino)phenyl)acetate, 97%, 97% (CAS 112918-77-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HCG8-250mg |
| cas | 112918-77-1 |
| size | 250mg |
| availability | 8g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 83.60 Pln | |
| Chemat | 1g | 136.40 Pln | |
| Chemat | 5g | 443.60 Pln | |
| Chemat | 100mg | 78.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetate (CAS 112918-77-1) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetate. InChIKey: SWVCXLXHFUCMFW-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | methyl 2-[4-[(2-methylpropan-2-yl)oxycarbonylamino]phenyl]acetate |
| InChIKey | SWVCXLXHFUCMFW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=CC=C(C=C1)CC(=O)OC |
Computed by PubChem (NCBI)