CAS 895577-21-6 appears in our catalog under these names: 4-(1-((tert-Butoxycarbonyl)amino)ethyl)benzoic acid, 95%, 4–(1–((tert–Butoxycarbonyl)amino)ethyl)benzoic acid, 4-(1-{((tert-butoxy)carbonyl)amino}ethyl)benzoic acid, 4-(1-((tert-Butoxycarbonyl)amino)ethyl)benzoic acid, 95%, 95%, 4-(1-((tert-Butoxycarbonyl)amino)ethyl)benzoic acid, 97%. Offered by: Combi-blocks, GLPBio, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 5g, 1g, 2,5g.
4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid (CAS 895577-21-6) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid. InChIKey: OKRPFRUXMOYTDV-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | 4-[1-[(2-methylpropan-2-yl)oxycarbonylamino]ethyl]benzoic acid |
| InChIKey | OKRPFRUXMOYTDV-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)