CAS 28044-77-1 appears in our catalog under these names: tert-Butoxycarbonylamino-p-tolyl-acetic acid, 95%, 2–((tert–Butoxycarbonyl)amino)–2–(p–tolyl)acetic acid, 2-{((tert-Butoxy)carbonyl)amino}-2-(4-methylphenyl)acetic acid, N-BOC-2-(P-TOLYL)-DL-GLYCINE, 97%, Boc-DL-2-(p-tolyl)-Gly-OH, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Fluorochem, Ambeed. Available pack sizes: 250mg, 5g, 10g, 1g, 100mg, 0,5g.
2-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 28044-77-1) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 2-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: SNDBWQDZODFRCK-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | 2-(4-methylphenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | SNDBWQDZODFRCK-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C(C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)