CAS 390401-40-8 appears in our catalog under these names: 2-([(tert-Butoxy)carbonyl]amino)-2-phenylpropanoic acid, 95%, 2-(Boc-amino)-2-phenylpropanoic acid, 95%, 2-{((tert-Butoxy)carbonyl)amino}-2-phenylpropanoic acid, 2-(Boc-amino)-2-phenylpropanoic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, Biosynth, Chemat. Available pack sizes: 5g, 250mg, 1g, 2,5g.
2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylpropanoic acid (CAS 390401-40-8) is a chemical compound with the molecular formula C14H19NO4 and a molecular weight of 265.30 g/mol. IUPAC name: 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylpropanoic acid. InChIKey: WOGUASPHMADVMU-UHFFFAOYSA-N.
| Molecular formula | C14H19NO4 |
|---|---|
| Molecular weight | 265.30 g/mol |
| IUPAC name | 2-[(2-methylpropan-2-yl)oxycarbonylamino]-2-phenylpropanoic acid |
| InChIKey | WOGUASPHMADVMU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C)(C1=CC=CC=C1)C(=O)O |
Computed by PubChem (NCBI)