cas: 192650-54-7 — see every product listed under this CAS number, including other names
Methyl 2-(4-Amino-2-fluorophenyl)acetate, 98%, 98% (CAS 192650-54-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I3VH-250mg |
| cas | 192650-54-7 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 1g | 448.40 Pln | |
| Chemat | 5g | 1264.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-(4-amino-2-fluorophenyl)acetate (CAS 192650-54-7) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: methyl 2-(4-amino-2-fluorophenyl)acetate. InChIKey: JEMATMNWIDLWGH-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | methyl 2-(4-amino-2-fluorophenyl)acetate |
| InChIKey | JEMATMNWIDLWGH-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=C(C=C1)N)F |
Computed by PubChem (NCBI)