cas: 192650-54-7 — see every product listed under this CAS number, including other names
Methyl 2-(4-amino-2-fluorophenyl)acetate 98% (CAS 192650-54-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A563339-250mg |
| cas | 192650-54-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 242.44 Pln | |
| Ambeed | 1g | 487.19 Pln | |
| Ambeed | 5g | 1377.19 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A563339 |
Methyl 2-(4-amino-2-fluorophenyl)acetate (CAS 192650-54-7) is a chemical compound with the molecular formula C9H10FNO2 and a molecular weight of 183.18 g/mol. IUPAC name: methyl 2-(4-amino-2-fluorophenyl)acetate. InChIKey: JEMATMNWIDLWGH-UHFFFAOYSA-N.
| Molecular formula | C9H10FNO2 |
|---|---|
| Molecular weight | 183.18 g/mol |
| IUPAC name | methyl 2-(4-amino-2-fluorophenyl)acetate |
| InChIKey | JEMATMNWIDLWGH-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=C(C=C(C=C1)N)F |
Computed by PubChem (NCBI)