cas: 39718-97-3 — see every product listed under this CAS number, including other names
Methyl 2-(4-aminophenyl)propanoate 98% (CAS 39718-97-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A490376-100mg |
| cas | 39718-97-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 515.00 Pln | |
| Ambeed | 250mg | 776.44 Pln | |
| Ambeed | 1g | 1538.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A490376 |
Methyl 2-(4-aminophenyl)propanoate (CAS 39718-97-3) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: methyl 2-(4-aminophenyl)propanoate. InChIKey: JSQLPIGKVBUMBF-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | methyl 2-(4-aminophenyl)propanoate |
| InChIKey | JSQLPIGKVBUMBF-UHFFFAOYSA-N |
| SMILES | CC(C1=CC=C(C=C1)N)C(=O)OC |
Computed by PubChem (NCBI)