cas: 15964-80-4 — see every product listed under this CAS number, including other names
Methyl 2-(4-hydroxy-3-methoxyphenyl)acetate 98% (CAS 15964-80-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A179244-250mg |
| cas | 15964-80-4 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 1955.69 Pln | |
| Ambeed | 25g | 6772.81 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A179244 |
Methyl 2-(4-hydroxy-3-methoxyphenyl)acetate (CAS 15964-80-4) is a chemical compound with the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. IUPAC name: methyl 2-(4-hydroxy-3-methoxyphenyl)acetate. InChIKey: JJJSFAGPWHEUBT-UHFFFAOYSA-N.
| Molecular formula | C10H12O4 |
|---|---|
| Molecular weight | 196.20 g/mol |
| IUPAC name | methyl 2-(4-hydroxy-3-methoxyphenyl)acetate |
| InChIKey | JJJSFAGPWHEUBT-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)CC(=O)OC)O |
Computed by PubChem (NCBI)