cas: 57699-27-1 — see every product listed under this CAS number, including other names
Methyl 2-(4-nitrophenyl)-2-oxoacetate, 97% (CAS 57699-27-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 250mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A499369-1g |
| cas | 57699-27-1 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 7263.55 Pln | |
| AmBeed | 5g | 21735.28 Pln | |
| Fluorochem | 1g | 2622.01 Pln | |
| Fluorochem | 250mg | 841.39 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl 2-(4-nitrophenyl)-2-oxoacetate (CAS 57699-27-1) is a chemical compound with the molecular formula C9H7NO5 and a molecular weight of 209.16 g/mol. IUPAC name: methyl 2-(4-nitrophenyl)-2-oxoacetate. InChIKey: KCJNETLTNKSVGA-UHFFFAOYSA-N.
| Molecular formula | C9H7NO5 |
|---|---|
| Molecular weight | 209.16 g/mol |
| IUPAC name | methyl 2-(4-nitrophenyl)-2-oxoacetate |
| InChIKey | KCJNETLTNKSVGA-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)