cas: 1073129-57-3 — see every product listed under this CAS number, including other names
Methyl 2-Chloro-6-(trifluoromethyl)nicotinate, 98% (CAS 1073129-57-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F066925-100MG |
| cas | 1073129-57-3 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 320.74 Pln | |
| Fluorochem | 250mg | 388.42 Pln | |
| Fluorochem | 500mg | 716.43 Pln | |
| Fluorochem | 1g | 726.85 Pln | |
| Fluorochem | 2.5g | 1575.50 Pln | |
| Fluorochem | 5g | 2663.66 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Methyl 2-chloro-6-(trifluoromethyl)pyridine-3-carboxylate (CAS 1073129-57-3) is a chemical compound with the molecular formula C8H5ClF3NO2 and a molecular weight of 239.58 g/mol. IUPAC name: methyl 2-chloro-6-(trifluoromethyl)pyridine-3-carboxylate. InChIKey: OFOKILFDGSZHKO-UHFFFAOYSA-N.
| Molecular formula | C8H5ClF3NO2 |
|---|---|
| Molecular weight | 239.58 g/mol |
| IUPAC name | methyl 2-chloro-6-(trifluoromethyl)pyridine-3-carboxylate |
| InChIKey | OFOKILFDGSZHKO-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(N=C(C=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)