cas: 4546-48-9 — see every product listed under this CAS number, including other names
Methyl 2-Phenylquinoline-4-carboxylate, 95%, 95% (CAS 4546-48-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch117ZNA-250mg |
| cas | 4546-48-9 |
| size | 250mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 146.00 Pln | |
| Chemat | 1g | 251.60 Pln | |
| Chemat | 5g | 630.80 Pln | |
| Chemat | 10g | 1053.20 Pln | |
| Chemat | 25g | 2046.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Methyl 2-phenylquinoline-4-carboxylate (CAS 4546-48-9) is a chemical compound with the molecular formula C17H13NO2 and a molecular weight of 263.29 g/mol. IUPAC name: methyl 2-phenylquinoline-4-carboxylate. InChIKey: FDNMMBMNYRTPLC-UHFFFAOYSA-N.
| Molecular formula | C17H13NO2 |
|---|---|
| Molecular weight | 263.29 g/mol |
| IUPAC name | methyl 2-phenylquinoline-4-carboxylate |
| InChIKey | FDNMMBMNYRTPLC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=NC2=CC=CC=C21)C3=CC=CC=C3 |
Computed by PubChem (NCBI)