cas: 20676-54-4 — see every product listed under this CAS number, including other names
Methyl 2-acetamido-5-chlorobenzoate, ≥98%(GC), ≥98%(GC) (CAS 20676-54-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 250g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113INW-5g |
| cas | 20676-54-4 |
| size | 5g |
| availability | 750g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 184.40 Pln | |
| Chemat | 50g | 318.80 Pln | |
| Chemat | 100g | 554.00 Pln | |
| Chemat | 250g | 1086.80 Pln |
| purity | ≥98%(GC) |
|---|---|
| delivery time | 3 weeks |
Methyl 2-acetamido-5-chlorobenzoate (CAS 20676-54-4) is a chemical compound with the molecular formula C10H10ClNO3 and a molecular weight of 227.64 g/mol. IUPAC name: methyl 2-acetamido-5-chlorobenzoate. InChIKey: TVAAIYFBEWHVCV-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO3 |
|---|---|
| Molecular weight | 227.64 g/mol |
| IUPAC name | methyl 2-acetamido-5-chlorobenzoate |
| InChIKey | TVAAIYFBEWHVCV-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=C(C=C(C=C1)Cl)C(=O)OC |
Computed by PubChem (NCBI)